C31H31ClF2N4O4 — CID 159918845
methyl 2-[(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-2-oxopiperazin-1-yl]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate (PubChem CID 159918845) has the molecular formula C31H31ClF2N4O4 and a molecular weight of 597.06 g/mol. Its IUPAC name is methyl 2-[(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-2-oxopiperazin-1-yl]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate.
| Compound Name | methyl 2-[(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-2-oxopiperazin-1-yl]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate |
|---|---|
| PubChem CID | 159918845 |
| Molecular Formula | C31H31ClF2N4O4 |
| Molecular Weight | 597.06 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | methyl 2-[(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-2-oxopiperazin-1-yl]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](N1CCN(c3c(F)ccc(Cl)c3F)CC1=O)c1cc-2ccn1 |
| InChI | InChI=1S/C31H31ClF2N4O4/c1-18-4-3-5-26(38-13-12-37(17-27(38)39)30-23(33)9-8-22(32)29(30)34)25-16-20(10-11-35-25)21-7-6-19(15-28(40)42-2)14-24(21)36-31(18)41/h6-11,14,16,18,26H,3-5,12-13,15,17H2,1-2H3,(H,36,41)/t18-,26+/m1/s1 |
| InChIKey | NYDITGACWPFLLC-DWXRJYCRSA-N |
| XLogP | 5.54 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|