C34H30ClF2N5O2 — CID 146923244
(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-5-(pyrimidin-4-ylmethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one (PubChem CID 146923244) has the molecular formula C34H30ClF2N5O2 and a molecular weight of 614.10 g/mol. Its IUPAC name is (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-5-(pyrimidin-4-ylmethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one.
| Compound Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-5-(pyrimidin-4-ylmethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 146923244 |
| Molecular Formula | C34H30ClF2N5O2 |
| Molecular Weight | 614.10 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-10-methyl-5-(pyrimidin-4-ylmethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
| SMILES | C[C@@H]1CCC[C@H](N2CCC(c3c(F)ccc(Cl)c3F)=CC2=O)c2cc(ccn2)-c2ccc(Cc3ccncn3)cc2NC1=O |
| InChI | InChI=1S/C34H30ClF2N5O2/c1-20-3-2-4-30(42-14-11-23(18-31(42)43)32-27(36)8-7-26(35)33(32)37)29-17-22(9-13-39-29)25-6-5-21(16-28(25)41-34(20)44)15-24-10-12-38-19-40-24/h5-10,12-13,16-20,30H,2-4,11,14-15H2,1H3,(H,41,44)/t20-,30+/m1/s1 |
| InChIKey | ADPBYFVQQSOCCM-KEEVHDRGSA-N |
| XLogP | 7.18 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.10 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|