C33H31ClF2N4O2 — CID 126607085
17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5,6,13-trimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one (PubChem CID 126607085) has the molecular formula C33H31ClF2N4O2 and a molecular weight of 589.09 g/mol. Its IUPAC name is 17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5,6,13-trimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one.
| Compound Name | 17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5,6,13-trimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one |
|---|---|
| PubChem CID | 126607085 |
| Molecular Formula | C33H31ClF2N4O2 |
| Molecular Weight | 589.09 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 17-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5,6,13-trimethyl-7,11,19-triazatetracyclo[16.3.1.02,10.04,8]docosa-1(22),2(10),3,5,8,18,20-heptaen-12-one |
| SMILES | Cc1[nH]c2cc3c(cc2c1C)-c1ccnc(c1)C(N1CCC(c2c(F)ccc(Cl)c2F)=CC1=O)CCCC(C)C(=O)N3 |
| InChI | InChI=1S/C33H31ClF2N4O2/c1-17-5-4-6-29(40-12-10-21(14-30(40)41)31-25(35)8-7-24(34)32(31)36)28-13-20(9-11-37-28)23-15-22-18(2)19(3)38-26(22)16-27(23)39-33(17)42/h7-9,11,13-17,29,38H,4-6,10,12H2,1-3H3,(H,39,42) |
| InChIKey | AFSLWHNVBZEIQG-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.09 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|