C29H26FN9O4 — CID 139268801
methyl N-[(14R)-14-[5-[5-fluoro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 139268801) has the molecular formula C29H26FN9O4 and a molecular weight of 583.58 g/mol. Its IUPAC name is methyl N-[(14R)-14-[5-[5-fluoro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(14R)-14-[5-[5-fluoro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 139268801 |
| Molecular Formula | C29H26FN9O4 |
| Molecular Weight | 583.58 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | methyl N-[(14R)-14-[5-[5-fluoro-2-(tetrazol-1-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CCCC[C@H](c1ccc(-c3cc(F)ccc3-n3cnnn3)c[n+]1[O-])c1ncc-2[nH]1 |
| InChI | InChI=1S/C29H26FN9O4/c1-43-29(41)33-19-8-9-20-23(13-19)34-27(40)5-3-2-4-21(28-31-14-24(20)35-28)26-10-6-17(15-39(26)42)22-12-18(30)7-11-25(22)38-16-32-36-37-38/h6-16,21H,2-5H2,1H3,(H,31,35)(H,33,41)(H,34,40)/t21-/m1/s1 |
| InChIKey | FLUCBLLJFWRIKM-OAQYLSRUSA-N |
| XLogP | 4.31 |
| TPSA | 166.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|