C29H23ClFN5O3 — CID 139268802
(14R)-14-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one (PubChem CID 139268802) has the molecular formula C29H23ClFN5O3 and a molecular weight of 543.99 g/mol. Its IUPAC name is (14R)-14-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one.
| Compound Name | (14R)-14-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
|---|---|
| PubChem CID | 139268802 |
| Molecular Formula | C29H23ClFN5O3 |
| Molecular Weight | 543.99 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | (14R)-14-[5-[5-chloro-2-(1,3-oxazol-5-yl)phenyl]-1-oxidopyridin-1-ium-2-yl]-4-fluoro-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-9-one |
| SMILES | O=C1CCCC[C@H](c2ccc(-c3cc(Cl)ccc3-c3cnco3)c[n+]2[O-])c2ncc([nH]2)-c2cc(F)ccc2N1 |
| InChI | InChI=1S/C29H23ClFN5O3/c30-18-6-8-20(27-14-32-16-39-27)22(11-18)17-5-10-26(36(38)15-17)21-3-1-2-4-28(37)34-24-9-7-19(31)12-23(24)25-13-33-29(21)35-25/h5-16,21H,1-4H2,(H,33,35)(H,34,37)/t21-/m1/s1 |
| InChIKey | WGCNTVPWRMGTQZ-OAQYLSRUSA-N |
| XLogP | 6.47 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.99 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|