About sodium pyrimidine-2-sulfinate
sodium pyrimidine-2-sulfinate (PubChem CID 139269667) has the molecular formula C4H3N2NaO2S
and a molecular weight of 166.14 g/mol. Its IUPAC name is sodium pyrimidine-2-sulfinate.
Molecular Properties
| Compound Name | sodium pyrimidine-2-sulfinate |
| PubChem CID | 139269667 |
| Molecular Formula | C4H3N2NaO2S |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 165.98 |
| IUPAC Name | sodium pyrimidine-2-sulfinate |
| SMILES | O=S([O-])c1ncccn1.[Na+] |
| InChI | InChI=1S/C4H4N2O2S.Na/c7-9(8)4-5-2-1-3-6-4;/h1-3H,(H,7,8);/q;+1/p-1 |
| InChIKey | YFKHXLGPONXLRC-UHFFFAOYSA-M |
| XLogP | -3.28 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium pyrimidine-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium pyrimidine-2-sulfinate?
The IUPAC name of sodium pyrimidine-2-sulfinate (CID 139269667) is sodium pyrimidine-2-sulfinate.
What is the SMILES notation for sodium pyrimidine-2-sulfinate?
The canonical SMILES for sodium pyrimidine-2-sulfinate is O=S([O-])c1ncccn1.[Na+].
What is the InChIKey of sodium pyrimidine-2-sulfinate?
The InChIKey is YFKHXLGPONXLRC-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H4N2O2S.Na/c7-9(8)4-5-2-1-3-6-4;/h1-3H,(H,7,8);/q;+1/p-1.
What are the key properties of sodium pyrimidine-2-sulfinate?
sodium pyrimidine-2-sulfinate has a molecular weight of 166.14 g/mol, XLogP of -3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium pyrimidine-2-sulfinate is sourced from PubChem (CID 139269667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).