C19H22BN3O2 — CID 139271576
N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazol-1-amine (PubChem CID 139271576) has the molecular formula C19H22BN3O2 and a molecular weight of 335.22 g/mol. Its IUPAC name is N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazol-1-amine.
| Compound Name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazol-1-amine |
|---|---|
| PubChem CID | 139271576 |
| Molecular Formula | C19H22BN3O2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indazol-1-amine |
| SMILES | CC1(C)OB(c2ccc(Nn3ncc4ccccc43)cc2)OC1(C)C |
| InChI | InChI=1S/C19H22BN3O2/c1-18(2)19(3,4)25-20(24-18)15-9-11-16(12-10-15)22-23-17-8-6-5-7-14(17)13-21-23/h5-13,22H,1-4H3 |
| InChIKey | LXJPXWRTFWAXIH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|