C8H23N5S2 — CID 139292702
(2S)-2-amino-2-[[(2R)-2-amino-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol (PubChem CID 139292702) has the molecular formula C8H23N5S2 and a molecular weight of 253.44 g/mol. Its IUPAC name is (2S)-2-amino-2-[[(2R)-2-amino-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol.
| Compound Name | (2S)-2-amino-2-[[(2R)-2-amino-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol |
|---|---|
| PubChem CID | 139292702 |
| Molecular Formula | C8H23N5S2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | (2S)-2-amino-2-[[(2R)-2-amino-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol |
| SMILES | CNC[C@@](N)(CS)NC[C@](N)(CS)NC |
| InChI | InChI=1S/C8H23N5S2/c1-11-3-8(10,6-15)13-4-7(9,5-14)12-2/h11-15H,3-6,9-10H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | DJDFFMKBVOXONT-SFYZADRCSA-N |
| XLogP | -1.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|