C10H24N2S2 — CID 16727462
2-[2-(1-sulfanylbutan-2-ylamino)ethylamino]butane-1-thiol (PubChem CID 16727462) has the molecular formula C10H24N2S2 and a molecular weight of 236.45 g/mol. Its IUPAC name is 2-[2-(1-sulfanylbutan-2-ylamino)ethylamino]butane-1-thiol.
| Compound Name | 2-[2-(1-sulfanylbutan-2-ylamino)ethylamino]butane-1-thiol |
|---|---|
| PubChem CID | 16727462 |
| Molecular Formula | C10H24N2S2 |
| Molecular Weight | 236.45 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-[2-(1-sulfanylbutan-2-ylamino)ethylamino]butane-1-thiol |
| SMILES | CCC(CS)NCCNC(CC)CS |
| InChI | InChI=1S/C10H24N2S2/c1-3-9(7-13)11-5-6-12-10(4-2)8-14/h9-14H,3-8H2,1-2H3 |
| InChIKey | TVLZRBORRGRUIR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|