C9H21F2N3S2 — CID 134314013
(2S)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoro-3-(methylamino)propane-1-thiol (PubChem CID 134314013) has the molecular formula C9H21F2N3S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is (2S)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoro-3-(methylamino)propane-1-thiol.
| Compound Name | (2S)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoro-3-(methylamino)propane-1-thiol |
|---|---|
| PubChem CID | 134314013 |
| Molecular Formula | C9H21F2N3S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (2S)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoro-3-(methylamino)propane-1-thiol |
| SMILES | CCNC(F)(CS)CN[C@@](F)(CS)CNC |
| InChI | InChI=1S/C9H21F2N3S2/c1-3-13-9(11,7-16)5-14-8(10,6-15)4-12-2/h12-16H,3-7H2,1-2H3/t8-,9?/m1/s1 |
| InChIKey | YUOXGYMYEQKTGF-VEDVMXKPSA-N |
| XLogP | 0.60 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|