C9H22FN3S — CID 134314020
(2S)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-3-(methylamino)propane-1-thiol (PubChem CID 134314020) has the molecular formula C9H22FN3S and a molecular weight of 223.36 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-3-(methylamino)propane-1-thiol.
| Compound Name | (2S)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-3-(methylamino)propane-1-thiol |
|---|---|
| PubChem CID | 134314020 |
| Molecular Formula | C9H22FN3S |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | (2S)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-3-(methylamino)propane-1-thiol |
| SMILES | CCN[C@@](C)(F)CN[C@H](CS)CNC |
| InChI | InChI=1S/C9H22FN3S/c1-4-13-9(2,10)7-12-8(6-14)5-11-3/h8,11-14H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | NKNPQLIHJLUEND-DTWKUNHWSA-N |
| XLogP | 0.39 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|