C10H23F2N3S — CID 134313990
3-(ethylamino)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-2-fluoropropane-1-thiol (PubChem CID 134313990) has the molecular formula C10H23F2N3S and a molecular weight of 255.38 g/mol. Its IUPAC name is 3-(ethylamino)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-2-fluoropropane-1-thiol.
| Compound Name | 3-(ethylamino)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-2-fluoropropane-1-thiol |
|---|---|
| PubChem CID | 134313990 |
| Molecular Formula | C10H23F2N3S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-(ethylamino)-2-[[(2S)-2-(ethylamino)-2-fluoropropyl]amino]-2-fluoropropane-1-thiol |
| SMILES | CCNCC(F)(CS)NC[C@](C)(F)NCC |
| InChI | InChI=1S/C10H23F2N3S/c1-4-13-7-10(12,8-16)15-6-9(3,11)14-5-2/h13-16H,4-8H2,1-3H3/t9-,10?/m1/s1 |
| InChIKey | IYTZFDNRNPNWAZ-YHMJZVADSA-N |
| XLogP | 1.08 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|