C10H23F2N3S2 — CID 134314012
(2S)-3-(ethylamino)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoropropane-1-thiol (PubChem CID 134314012) has the molecular formula C10H23F2N3S2 and a molecular weight of 287.44 g/mol. Its IUPAC name is (2S)-3-(ethylamino)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoropropane-1-thiol.
| Compound Name | (2S)-3-(ethylamino)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoropropane-1-thiol |
|---|---|
| PubChem CID | 134314012 |
| Molecular Formula | C10H23F2N3S2 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2S)-3-(ethylamino)-2-[[2-(ethylamino)-2-fluoro-3-sulfanylpropyl]amino]-2-fluoropropane-1-thiol |
| SMILES | CCNC[C@](F)(CS)NCC(F)(CS)NCC |
| InChI | InChI=1S/C10H23F2N3S2/c1-3-13-5-9(11,7-16)15-6-10(12,8-17)14-4-2/h13-17H,3-8H2,1-2H3/t9-,10?/m1/s1 |
| InChIKey | FIPNHVZJBAKCBP-YHMJZVADSA-N |
| XLogP | 0.99 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|