C8H19F2N3S2 — CID 134313980
(2S)-2-fluoro-2-[[2-fluoro-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol (PubChem CID 134313980) has the molecular formula C8H19F2N3S2 and a molecular weight of 259.39 g/mol. Its IUPAC name is (2S)-2-fluoro-2-[[2-fluoro-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol.
| Compound Name | (2S)-2-fluoro-2-[[2-fluoro-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol |
|---|---|
| PubChem CID | 134313980 |
| Molecular Formula | C8H19F2N3S2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | (2S)-2-fluoro-2-[[2-fluoro-2-(methylamino)-3-sulfanylpropyl]amino]-3-(methylamino)propane-1-thiol |
| SMILES | CNC[C@](F)(CS)NCC(F)(CS)NC |
| InChI | InChI=1S/C8H19F2N3S2/c1-11-3-8(10,6-15)13-4-7(9,5-14)12-2/h11-15H,3-6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | AAQJQBJQAHVVHI-BRFYHDHCSA-N |
| XLogP | 0.21 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|