C17H12Br2O4 — CID 139293216
dimethyl 3,6-dibromofluorene-9,9-dicarboxylate (PubChem CID 139293216) has the molecular formula C17H12Br2O4 and a molecular weight of 440.09 g/mol. Its IUPAC name is dimethyl 3,6-dibromofluorene-9,9-dicarboxylate.
| Compound Name | dimethyl 3,6-dibromofluorene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 139293216 |
| Molecular Formula | C17H12Br2O4 |
| Molecular Weight | 440.09 g/mol |
| Exact Mass | 437.91 |
| IUPAC Name | dimethyl 3,6-dibromofluorene-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)c2ccc(Br)cc2-c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H12Br2O4/c1-22-15(20)17(16(21)23-2)13-5-3-9(18)7-11(13)12-8-10(19)4-6-14(12)17/h3-8H,1-2H3 |
| InChIKey | RTDZLDCXOZHPBR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|