C15H13ClFN3OS — CID 139293387
2-[(4S)-4-(3-chloro-5-fluorophenyl)-7-sulfanylidene-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-en-9-yl]acetamide (PubChem CID 139293387) has the molecular formula C15H13ClFN3OS and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-[(4S)-4-(3-chloro-5-fluorophenyl)-7-sulfanylidene-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-en-9-yl]acetamide.
| Compound Name | 2-[(4S)-4-(3-chloro-5-fluorophenyl)-7-sulfanylidene-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-en-9-yl]acetamide |
|---|---|
| PubChem CID | 139293387 |
| Molecular Formula | C15H13ClFN3OS |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-[(4S)-4-(3-chloro-5-fluorophenyl)-7-sulfanylidene-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-en-9-yl]acetamide |
| SMILES | NC(=O)Cc1[nH]c(=S)n2c1C1C[C@]1(c1cc(F)cc(Cl)c1)C2 |
| InChI | InChI=1S/C15H13ClFN3OS/c16-8-1-7(2-9(17)3-8)15-5-10(15)13-11(4-12(18)21)19-14(22)20(13)6-15/h1-3,10H,4-6H2,(H2,18,21)(H,19,22)/t10?,15-/m1/s1 |
| InChIKey | QUPWUFHYCKICIE-GENIYJEYSA-N |
| XLogP | 2.80 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|