C7H11FO7S — CID 139293448
1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 139293448) has the molecular formula C7H11FO7S and a molecular weight of 258.22 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 139293448 |
| Molecular Formula | C7H11FO7S |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCOC(=O)C(F)(CC(=O)OC)S(=O)(=O)O |
| InChI | InChI=1S/C7H11FO7S/c1-3-15-6(10)7(8,16(11,12)13)4-5(9)14-2/h3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | XNYOSYIYNNEREB-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|