1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid

C7H11FO7S — CID 139293448

IUPAC1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid
SMILESCCOC(=O)C(F)(CC(=O)OC)S(=O)(=O)O
InChIInChI=1S/C7H11FO7S/c1-3-15-6(10)7(8,16(11,12)13)4-5(9)14-2/h3-4H2,1-2H3,(H,11,12,13)
InChIKeyXNYOSYIYNNEREB-UHFFFAOYSA-N
MW258.22 g/mol
LogP-0.33
Rot. Bonds5

About 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid

1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 139293448) has the molecular formula C7H11FO7S and a molecular weight of 258.22 g/mol. Its IUPAC name is 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid.

Molecular Properties

Compound Name1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid
PubChem CID139293448
Molecular FormulaC7H11FO7S
Molecular Weight258.22 g/mol
Exact Mass258.02
IUPAC Name1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid
SMILESCCOC(=O)C(F)(CC(=O)OC)S(=O)(=O)O
InChIInChI=1S/C7H11FO7S/c1-3-15-6(10)7(8,16(11,12)13)4-5(9)14-2/h3-4H2,1-2H3,(H,11,12,13)
InChIKeyXNYOSYIYNNEREB-UHFFFAOYSA-N
XLogP-0.33
TPSA106.97 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.22
LogP ≤ 5-0.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid?
The IUPAC name of 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid (CID 139293448) is 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid.
What is the SMILES notation for 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid?
The canonical SMILES for 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid is CCOC(=O)C(F)(CC(=O)OC)S(=O)(=O)O.
What is the InChIKey of 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid?
The InChIKey is XNYOSYIYNNEREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11FO7S/c1-3-15-6(10)7(8,16(11,12)13)4-5(9)14-2/h3-4H2,1-2H3,(H,11,12,13).
What are the key properties of 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid?
1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid has a molecular weight of 258.22 g/mol, XLogP of -0.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-fluoro-4-methoxy-1,4-dioxobutane-2-sulfonic acid is sourced from PubChem (CID 139293448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).