C18H16Cl3N3O2 — CID 139295435
N-(5-chloro-2-pyridinyl)-2-[4-(2,3-dichlorophenyl)piperidin-1-yl]-2-oxoacetamide (PubChem CID 139295435) has the molecular formula C18H16Cl3N3O2 and a molecular weight of 412.70 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[4-(2,3-dichlorophenyl)piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[4-(2,3-dichlorophenyl)piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 139295435 |
| Molecular Formula | C18H16Cl3N3O2 |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[4-(2,3-dichlorophenyl)piperidin-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C(=O)N1CCC(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H16Cl3N3O2/c19-12-4-5-15(22-10-12)23-17(25)18(26)24-8-6-11(7-9-24)13-2-1-3-14(20)16(13)21/h1-5,10-11H,6-9H2,(H,22,23,25) |
| InChIKey | NOBOQNBNCLXBQZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|