C23H24F2N6O — CID 139297620
1-(3,5-difluorophenyl)-N-[3-methyl-5-[(1R,4R)-5-(oxetan-3-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-1,2,4-triazol-3-amine (PubChem CID 139297620) has the molecular formula C23H24F2N6O and a molecular weight of 438.48 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-[3-methyl-5-[(1R,4R)-5-(oxetan-3-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-1,2,4-triazol-3-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-[3-methyl-5-[(1R,4R)-5-(oxetan-3-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 139297620 |
| Molecular Formula | C23H24F2N6O |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-[3-methyl-5-[(1R,4R)-5-(oxetan-3-yl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-1,2,4-triazol-3-amine |
| SMILES | Cc1cc(Nc2ncn(-c3cc(F)cc(F)c3)n2)cc(N2C[C@H]3C[C@@H]2CN3C2COC2)c1 |
| InChI | InChI=1S/C23H24F2N6O/c1-14-2-17(27-23-26-13-31(28-23)19-5-15(24)4-16(25)6-19)7-18(3-14)29-9-21-8-20(29)10-30(21)22-11-32-12-22/h2-7,13,20-22H,8-12H2,1H3,(H,27,28)/t20-,21-/m1/s1 |
| InChIKey | MVENGGVXIJFMPS-NHCUHLMSSA-N |
| XLogP | 3.26 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |