C21H38ClN — CID 139299496
benzyl-(2,4-diethyloctyl)-dimethylazanium chloride (PubChem CID 139299496) has the molecular formula C21H38ClN and a molecular weight of 340.00 g/mol. Its IUPAC name is benzyl-(2,4-diethyloctyl)-dimethylazanium chloride.
| Compound Name | benzyl-(2,4-diethyloctyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 139299496 |
| Molecular Formula | C21H38ClN |
| Molecular Weight | 340.00 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | benzyl-(2,4-diethyloctyl)-dimethylazanium chloride |
| SMILES | CCCCC(CC)CC(CC)C[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H38N.ClH/c1-6-9-13-19(7-2)16-20(8-3)17-22(4,5)18-21-14-11-10-12-15-21;/h10-12,14-15,19-20H,6-9,13,16-18H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GZMAFAJBXPINHQ-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.00 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|