C13H13NO3 — CID 139305530
3-[(E)-5-phenylpent-4-enyl]-1,4,2-dioxazol-5-one (PubChem CID 139305530) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-[(E)-5-phenylpent-4-enyl]-1,4,2-dioxazol-5-one.
| Compound Name | 3-[(E)-5-phenylpent-4-enyl]-1,4,2-dioxazol-5-one |
|---|---|
| PubChem CID | 139305530 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-[(E)-5-phenylpent-4-enyl]-1,4,2-dioxazol-5-one |
| SMILES | O=c1onc(CCC/C=C/c2ccccc2)o1 |
| InChI | InChI=1S/C13H13NO3/c15-13-16-12(14-17-13)10-6-2-5-9-11-7-3-1-4-8-11/h1,3-5,7-9H,2,6,10H2/b9-5+ |
| InChIKey | DYHOJSVWVCSKHP-WEVVVXLNSA-N |
| XLogP | 2.66 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|