C12H11NO3 — CID 177224274
3-[(E)-4-phenylbut-3-enyl]-1,4,2-dioxazol-5-one (PubChem CID 177224274) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-[(E)-4-phenylbut-3-enyl]-1,4,2-dioxazol-5-one.
| Compound Name | 3-[(E)-4-phenylbut-3-enyl]-1,4,2-dioxazol-5-one |
|---|---|
| PubChem CID | 177224274 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-[(E)-4-phenylbut-3-enyl]-1,4,2-dioxazol-5-one |
| SMILES | O=c1onc(CC/C=C/c2ccccc2)o1 |
| InChI | InChI=1S/C12H11NO3/c14-12-15-11(13-16-12)9-5-4-8-10-6-2-1-3-7-10/h1-4,6-8H,5,9H2/b8-4+ |
| InChIKey | ZEQMHGGGRRLLDD-XBXARRHUSA-N |
| XLogP | 2.27 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |