C19H15Cl2N5 — CID 139308623
3-[(2,6-dichlorophenyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine (PubChem CID 139308623) has the molecular formula C19H15Cl2N5 and a molecular weight of 384.27 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine |
|---|---|
| PubChem CID | 139308623 |
| Molecular Formula | C19H15Cl2N5 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-8-(2-methylphenyl)-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(-c3ccccc3C)[nH]c12 |
| InChI | InChI=1S/C19H15Cl2N5/c1-11-5-2-3-6-12(11)18-24-16-17(22)23-10-26(19(16)25-18)9-13-14(20)7-4-8-15(13)21/h2-8,10,22H,9H2,1H3,(H,24,25)/b22-17- |
| InChIKey | QSQZDOBAEMNVJS-XLNRJJMWSA-N |
| XLogP | 4.57 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |