C18H12Cl3N5 — CID 138740903
8-(3-chlorophenyl)-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine (PubChem CID 138740903) has the molecular formula C18H12Cl3N5 and a molecular weight of 404.69 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine.
| Compound Name | 8-(3-chlorophenyl)-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine |
|---|---|
| PubChem CID | 138740903 |
| Molecular Formula | C18H12Cl3N5 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | 8-(3-chlorophenyl)-3-[(2,6-dichlorophenyl)methyl]-7H-purin-6-imine |
| SMILES | [H]/N=c1\ncn(Cc2c(Cl)cccc2Cl)c2nc(-c3cccc(Cl)c3)[nH]c12 |
| InChI | InChI=1S/C18H12Cl3N5/c19-11-4-1-3-10(7-11)17-24-15-16(22)23-9-26(18(15)25-17)8-12-13(20)5-2-6-14(12)21/h1-7,9,22H,8H2,(H,24,25)/b22-16- |
| InChIKey | HCYQTSDASCKFCU-JWGURIENSA-N |
| XLogP | 4.91 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |