C16H16N2O3S — CID 139309338
6-(dihydroxymethyl)-5-methyl-2-[(3-methylphenyl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 139309338) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 6-(dihydroxymethyl)-5-methyl-2-[(3-methylphenyl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-(dihydroxymethyl)-5-methyl-2-[(3-methylphenyl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 139309338 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 6-(dihydroxymethyl)-5-methyl-2-[(3-methylphenyl)methyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cccc(Cc2nc3sc(C(O)O)c(C)c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C16H16N2O3S/c1-8-4-3-5-10(6-8)7-11-17-14(19)12-9(2)13(16(20)21)22-15(12)18-11/h3-6,16,20-21H,7H2,1-2H3,(H,17,18,19) |
| InChIKey | KVZFIBAWXRZUEM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|