C66H44N4 — CID 139313143
2-(N-[6-(N-(2-cyano-4,6-diphenylphenyl)anilino)-10b,10c-dihydropyren-1-yl]anilino)-3,5-diphenylbenzonitrile (PubChem CID 139313143) has the molecular formula C66H44N4 and a molecular weight of 893.11 g/mol. Its IUPAC name is 2-(N-[6-(N-(2-cyano-4,6-diphenylphenyl)anilino)-10b,10c-dihydropyren-1-yl]anilino)-3,5-diphenylbenzonitrile.
| Compound Name | 2-(N-[6-(N-(2-cyano-4,6-diphenylphenyl)anilino)-10b,10c-dihydropyren-1-yl]anilino)-3,5-diphenylbenzonitrile |
|---|---|
| PubChem CID | 139313143 |
| Molecular Formula | C66H44N4 |
| Molecular Weight | 893.11 g/mol |
| Exact Mass | 892.36 |
| IUPAC Name | 2-(N-[6-(N-(2-cyano-4,6-diphenylphenyl)anilino)-10b,10c-dihydropyren-1-yl]anilino)-3,5-diphenylbenzonitrile |
| SMILES | N#Cc1cc(-c2ccccc2)cc(-c2ccccc2)c1N(C1=CC=C2C=CC3=C(N(c4ccccc4)c4c(C#N)cc(-c5ccccc5)cc4-c4ccccc4)C=CC4=CC=C1C2C43)c1ccccc1 |
| InChI | InChI=1S/C66H44N4/c67-43-53-39-51(45-19-7-1-8-20-45)41-59(47-23-11-3-12-24-47)65(53)69(55-27-15-5-16-28-55)61-37-33-49-32-36-58-62(38-34-50-31-35-57(61)63(49)64(50)58)70(56-29-17-6-18-30-56)66-54(44-68)40-52(46-21-9-2-10-22-46)42-60(66)48-25-13-4-14-26-48/h1-42,63-64H |
| InChIKey | ZTLSKPHBPPCXRK-UHFFFAOYSA-N |
| XLogP | 16.39 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.11 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |