C66H44N4 — CID 59357713
3-(N-[6-(N-(3-isocyanophenyl)-2,4-diphenylanilino)-1,10c-dihydropyren-1-yl]-2,4-diphenylanilino)benzonitrile (PubChem CID 59357713) has the molecular formula C66H44N4 and a molecular weight of 893.11 g/mol. Its IUPAC name is 3-(N-[6-(N-(3-isocyanophenyl)-2,4-diphenylanilino)-1,10c-dihydropyren-1-yl]-2,4-diphenylanilino)benzonitrile.
| Compound Name | 3-(N-[6-(N-(3-isocyanophenyl)-2,4-diphenylanilino)-1,10c-dihydropyren-1-yl]-2,4-diphenylanilino)benzonitrile |
|---|---|
| PubChem CID | 59357713 |
| Molecular Formula | C66H44N4 |
| Molecular Weight | 893.11 g/mol |
| Exact Mass | 892.36 |
| IUPAC Name | 3-(N-[6-(N-(3-isocyanophenyl)-2,4-diphenylanilino)-1,10c-dihydropyren-1-yl]-2,4-diphenylanilino)benzonitrile |
| SMILES | [C-]#[N+]c1cccc(N(C2=C3C=CC4=C5C(=CC=C(C=C2)C35)C(N(c2cccc(C#N)c2)c2ccc(-c3ccccc3)cc2-c2ccccc2)C=C4)c2ccc(-c3ccccc3)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C66H44N4/c1-68-54-25-15-27-56(43-54)70(64-39-33-53(47-19-8-3-9-20-47)42-60(64)49-23-12-5-13-24-49)62-37-31-51-28-34-57-61(36-30-50-29-35-58(62)66(51)65(50)57)69(55-26-14-16-45(40-55)44-67)63-38-32-52(46-17-6-2-7-18-46)41-59(63)48-21-10-4-11-22-48/h2-43,61,66H |
| InChIKey | WGSWRGODXXZAGD-UHFFFAOYSA-N |
| XLogP | 16.86 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.11 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|