C78H76F6N2Si4 — CID 59358117
1-N,6-N-bis[2,4-bis(2-trimethylsilylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine (PubChem CID 59358117) has the molecular formula C78H76F6N2Si4 and a molecular weight of 1267.81 g/mol. Its IUPAC name is 1-N,6-N-bis[2,4-bis(2-trimethylsilylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[2,4-bis(2-trimethylsilylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine |
|---|---|
| PubChem CID | 59358117 |
| Molecular Formula | C78H76F6N2Si4 |
| Molecular Weight | 1267.81 g/mol |
| Exact Mass | 1266.50 |
| IUPAC Name | 1-N,6-N-bis[2,4-bis(2-trimethylsilylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine |
| SMILES | C[Si](C)(C)c1ccccc1-c1ccc(N(C2=C3C=CC4=C5C(=CC=C(C=C2)C35)C(N(c2cccc(C(F)(F)F)c2)c2ccc(-c3ccccc3[Si](C)(C)C)cc2-c2ccccc2[Si](C)(C)C)C=C4)c2cccc(C(F)(F)F)c2)c(-c2ccccc2[Si](C)(C)C)c1 |
| InChI | InChI=1S/C78H76F6N2Si4/c1-87(2,3)71-31-17-13-27-59(71)53-39-45-69(65(47-53)61-29-15-19-33-73(61)89(7,8)9)85(57-25-21-23-55(49-57)77(79,80)81)67-43-37-51-36-42-64-68(44-38-52-35-41-63(67)75(51)76(52)64)86(58-26-22-24-56(50-58)78(82,83)84)70-46-40-54(60-28-14-18-32-72(60)88(4,5)6)48-66(70)62-30-16-20-34-74(62)90(10,11)12/h13-50,67,76H,1-12H3 |
| InChIKey | XIJCAUPUUYXGGJ-UHFFFAOYSA-N |
| XLogP | 20.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1267.81 |
| LogP ≤ 5 | 20.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|