C70H52F6N2 — CID 59358029
1-N,6-N-bis[2,4-bis(4-methylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine (PubChem CID 59358029) has the molecular formula C70H52F6N2 and a molecular weight of 1035.19 g/mol. Its IUPAC name is 1-N,6-N-bis[2,4-bis(4-methylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[2,4-bis(4-methylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine |
|---|---|
| PubChem CID | 59358029 |
| Molecular Formula | C70H52F6N2 |
| Molecular Weight | 1035.19 g/mol |
| Exact Mass | 1034.40 |
| IUPAC Name | 1-N,6-N-bis[2,4-bis(4-methylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine |
| SMILES | Cc1ccc(-c2ccc(N(C3=C4C=CC5=C6C(=CC=C(C=C3)C46)C(N(c3cccc(C(F)(F)F)c3)c3ccc(-c4ccc(C)cc4)cc3-c3ccc(C)cc3)C=C5)c3cccc(C(F)(F)F)c3)c(-c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C70H52F6N2/c1-43-11-19-47(20-12-43)53-31-37-65(61(39-53)49-23-15-45(3)16-24-49)77(57-9-5-7-55(41-57)69(71,72)73)63-35-29-51-28-34-60-64(36-30-52-27-33-59(63)67(51)68(52)60)78(58-10-6-8-56(42-58)70(74,75)76)66-38-32-54(48-21-13-44(2)14-22-48)40-62(66)50-25-17-46(4)18-26-50/h5-42,63,68H,1-4H3 |
| InChIKey | VTVSJAKPTODUOY-UHFFFAOYSA-N |
| XLogP | 19.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1035.19 |
| LogP ≤ 5 | 19.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |