C74H60F6N2 — CID 59358050
1-N,6-N-bis[2,4-bis(2,6-dimethylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine (PubChem CID 59358050) has the molecular formula C74H60F6N2 and a molecular weight of 1091.30 g/mol. Its IUPAC name is 1-N,6-N-bis[2,4-bis(2,6-dimethylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[2,4-bis(2,6-dimethylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine |
|---|---|
| PubChem CID | 59358050 |
| Molecular Formula | C74H60F6N2 |
| Molecular Weight | 1091.30 g/mol |
| Exact Mass | 1090.47 |
| IUPAC Name | 1-N,6-N-bis[2,4-bis(2,6-dimethylphenyl)phenyl]-1-N,6-N-bis[3-(trifluoromethyl)phenyl]-1,10c-dihydropyrene-1,6-diamine |
| SMILES | Cc1cccc(C)c1-c1ccc(N(C2=C3C=CC4=C5C(=CC=C(C=C2)C35)C(N(c2cccc(C(F)(F)F)c2)c2ccc(-c3c(C)cccc3C)cc2-c2c(C)cccc2C)C=C4)c2cccc(C(F)(F)F)c2)c(-c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C74H60F6N2/c1-43-15-9-16-44(2)67(43)53-31-37-65(61(39-53)69-47(5)19-11-20-48(69)6)81(57-25-13-23-55(41-57)73(75,76)77)63-35-29-51-28-34-60-64(36-30-52-27-33-59(63)71(51)72(52)60)82(58-26-14-24-56(42-58)74(78,79)80)66-38-32-54(68-45(3)17-10-18-46(68)4)40-62(66)70-49(7)21-12-22-50(70)8/h9-42,63,72H,1-8H3 |
| InChIKey | KOOWUCJINSMEEL-UHFFFAOYSA-N |
| XLogP | 20.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.30 |
| LogP ≤ 5 | 20.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |