C10H16N6 — CID 139313856
3-imino-4-(piperidine-1-carboximidoyl)pyrazin-2-amine (PubChem CID 139313856) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 3-imino-4-(piperidine-1-carboximidoyl)pyrazin-2-amine.
| Compound Name | 3-imino-4-(piperidine-1-carboximidoyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 139313856 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-imino-4-(piperidine-1-carboximidoyl)pyrazin-2-amine |
| SMILES | [H]/N=C(\N1CCCCC1)n1ccnc(N)/c1=N\[H] |
| InChI | InChI=1S/C10H16N6/c11-8-9(12)16(7-4-14-8)10(13)15-5-2-1-3-6-15/h4,7,12-13H,1-3,5-6H2,(H2,11,14)/b12-9+,13-10+ |
| InChIKey | AXTLQTBIXTYRRL-JOWSBRCASA-N |
| XLogP | 0.21 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|