C16H21N5 — CID 23731008
3-(4-methylphenyl)-5-(piperidine-1-carboximidoyl)imidazol-4-amine (PubChem CID 23731008) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-(piperidine-1-carboximidoyl)imidazol-4-amine.
| Compound Name | 3-(4-methylphenyl)-5-(piperidine-1-carboximidoyl)imidazol-4-amine |
|---|---|
| PubChem CID | 23731008 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-(4-methylphenyl)-5-(piperidine-1-carboximidoyl)imidazol-4-amine |
| SMILES | [H]/N=C(/c1ncn(-c2ccc(C)cc2)c1N)N1CCCCC1 |
| InChI | InChI=1S/C16H21N5/c1-12-5-7-13(8-6-12)21-11-19-14(16(21)18)15(17)20-9-3-2-4-10-20/h5-8,11,17H,2-4,9-10,18H2,1H3/b17-15- |
| InChIKey | WIGIAKAGUJUEIM-ICFOKQHNSA-N |
| XLogP | 2.57 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|