C8H13N5 — CID 135965159
piperidin-1-yl(1H-1,2,4-triazol-5-yl)methanimine (PubChem CID 135965159) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is piperidin-1-yl(1H-1,2,4-triazol-5-yl)methanimine.
| Compound Name | piperidin-1-yl(1H-1,2,4-triazol-5-yl)methanimine |
|---|---|
| PubChem CID | 135965159 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | piperidin-1-yl(1H-1,2,4-triazol-5-yl)methanimine |
| SMILES | [H]/N=C(/c1ncn[nH]1)N1CCCCC1 |
| InChI | InChI=1S/C8H13N5/c9-7(8-10-6-11-12-8)13-4-2-1-3-5-13/h6,9H,1-5H2,(H,10,11,12)/b9-7- |
| InChIKey | FNPGAVMBVOAOPL-CLFYSBASSA-N |
| XLogP | 0.62 |
| TPSA | 68.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|