C15H17N3OS2 — CID 46287520
[4-amino-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 46287520) has the molecular formula C15H17N3OS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is [4-amino-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-amino-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 46287520 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [4-amino-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1ccc(-n2c(N)c(C(=O)N3CCCC3)sc2=S)cc1 |
| InChI | InChI=1S/C15H17N3OS2/c1-10-4-6-11(7-5-10)18-13(16)12(21-15(18)20)14(19)17-8-2-3-9-17/h4-7H,2-3,8-9,16H2,1H3 |
| InChIKey | NDCGMKYRZAPEQS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|