C16H19N3O2S2 — CID 22589815
[4-amino-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 22589815) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is [4-amino-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-amino-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 22589815 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | [4-amino-3-(4-ethoxyphenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CCOc1ccc(-n2c(N)c(C(=O)N3CCCC3)sc2=S)cc1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-2-21-12-7-5-11(6-8-12)19-14(17)13(23-16(19)22)15(20)18-9-3-4-10-18/h5-8H,2-4,9-10,17H2,1H3 |
| InChIKey | DRYJVFLMUOKDGX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|