C16H15N3O2S2 — CID 50761996
7-methyl-3-(pyrrolidine-1-carbonyl)-1-sulfanylidene-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one (PubChem CID 50761996) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 7-methyl-3-(pyrrolidine-1-carbonyl)-1-sulfanylidene-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one.
| Compound Name | 7-methyl-3-(pyrrolidine-1-carbonyl)-1-sulfanylidene-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one |
|---|---|
| PubChem CID | 50761996 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 7-methyl-3-(pyrrolidine-1-carbonyl)-1-sulfanylidene-4H-[1,3]thiazolo[3,4-a]quinazolin-5-one |
| SMILES | Cc1ccc2c(c1)c(=O)[nH]c1c(C(=O)N3CCCC3)sc(=S)n12 |
| InChI | InChI=1S/C16H15N3O2S2/c1-9-4-5-11-10(8-9)14(20)17-13-12(23-16(22)19(11)13)15(21)18-6-2-3-7-18/h4-5,8H,2-3,6-7H2,1H3,(H,17,20) |
| InChIKey | XGCQWFMPTPFTGA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|