C14H14ClN3OS2 — CID 42585324
[4-amino-3-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 42585324) has the molecular formula C14H14ClN3OS2 and a molecular weight of 339.87 g/mol. Its IUPAC name is [4-amino-3-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-amino-3-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42585324 |
| Molecular Formula | C14H14ClN3OS2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | [4-amino-3-(4-chlorophenyl)-2-sulfanylidene-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Nc1c(C(=O)N2CCCC2)sc(=S)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3OS2/c15-9-3-5-10(6-4-9)18-12(16)11(21-14(18)20)13(19)17-7-1-2-8-17/h3-6H,1-2,7-8,16H2 |
| InChIKey | QHNQEIWNRKVDJX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|