C30H59NO2 — CID 139315486
5-(6-methylundecan-6-yl)-3-(5-methylundecan-5-yloxy)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 139315486) has the molecular formula C30H59NO2 and a molecular weight of 465.81 g/mol. Its IUPAC name is 5-(6-methylundecan-6-yl)-3-(5-methylundecan-5-yloxy)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | 5-(6-methylundecan-6-yl)-3-(5-methylundecan-5-yloxy)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 139315486 |
| Molecular Formula | C30H59NO2 |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.45 |
| IUPAC Name | 5-(6-methylundecan-6-yl)-3-(5-methylundecan-5-yloxy)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | CCCCCCC(C)(CCCC)OC1COC2CN(C(C)(CCCCC)CCCCC)CC21 |
| InChI | InChI=1S/C30H59NO2/c1-7-11-15-18-22-30(6,21-14-10-4)33-28-25-32-27-24-31(23-26(27)28)29(5,19-16-12-8-2)20-17-13-9-3/h26-28H,7-25H2,1-6H3 |
| InChIKey | HUMLXGYYVCDGRL-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|