C33H66N2S — CID 139315711
5-(6-methyldodecan-6-yl)-N-(7-methyltridecan-7-yl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine (PubChem CID 139315711) has the molecular formula C33H66N2S and a molecular weight of 522.97 g/mol. Its IUPAC name is 5-(6-methyldodecan-6-yl)-N-(7-methyltridecan-7-yl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine.
| Compound Name | 5-(6-methyldodecan-6-yl)-N-(7-methyltridecan-7-yl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
|---|---|
| PubChem CID | 139315711 |
| Molecular Formula | C33H66N2S |
| Molecular Weight | 522.97 g/mol |
| Exact Mass | 522.49 |
| IUPAC Name | 5-(6-methyldodecan-6-yl)-N-(7-methyltridecan-7-yl)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
| SMILES | CCCCCCC(C)(CCCCCC)NC1CSC2CN(C(C)(CCCCC)CCCCCC)CC12 |
| InChI | InChI=1S/C33H66N2S/c1-7-11-15-19-22-32(5,23-20-16-12-8-2)34-30-28-36-31-27-35(26-29(30)31)33(6,24-18-14-10-4)25-21-17-13-9-3/h29-31,34H,7-28H2,1-6H3 |
| InChIKey | JVOXDIKHFZEURV-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.97 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|