C15H29FN2 — CID 139315573
N,2-ditert-butyl-3a-fluoro-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine (PubChem CID 139315573) has the molecular formula C15H29FN2 and a molecular weight of 256.41 g/mol. Its IUPAC name is N,2-ditert-butyl-3a-fluoro-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine.
| Compound Name | N,2-ditert-butyl-3a-fluoro-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 139315573 |
| Molecular Formula | C15H29FN2 |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | N,2-ditert-butyl-3a-fluoro-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
| SMILES | CC(C)(C)NC1CC2CN(C(C)(C)C)CC2(F)C1 |
| InChI | InChI=1S/C15H29FN2/c1-13(2,3)17-12-7-11-9-18(14(4,5)6)10-15(11,16)8-12/h11-12,17H,7-10H2,1-6H3 |
| InChIKey | RIHABGIKJNOJAW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |