About 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine
1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine (PubChem CID 139316959) has the molecular formula C4H10IN3
and a molecular weight of 227.05 g/mol. Its IUPAC name is 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine |
| PubChem CID | 139316959 |
| Molecular Formula | C4H10IN3 |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine |
| SMILES | C/N=C/C(NC)NI |
| InChI | InChI=1S/C4H10IN3/c1-6-3-4(7-2)8-5/h3-4,7-8H,1-2H3/b6-3+ |
| InChIKey | XKOBISFHEUKQBS-ZZXKWVIFSA-N |
| XLogP | 0.17 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine?
The IUPAC name of 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine (CID 139316959) is 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine.
What is the SMILES notation for 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine?
The canonical SMILES for 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine is C/N=C/C(NC)NI.
What is the InChIKey of 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine?
The InChIKey is XKOBISFHEUKQBS-ZZXKWVIFSA-N. The full InChI is InChI=1S/C4H10IN3/c1-6-3-4(7-2)8-5/h3-4,7-8H,1-2H3/b6-3+.
What are the key properties of 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine?
1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine has a molecular weight of 227.05 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-iodo-1-N-methyl-2-methyliminoethane-1,1-diamine is sourced from PubChem (CID 139316959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).