C18H36N4O4 — CID 139318625
(2S)-5-[[8-(butylamino)-8-oxooctyl]amino]-2-(carbamoylamino)pentanoic acid (PubChem CID 139318625) has the molecular formula C18H36N4O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2S)-5-[[8-(butylamino)-8-oxooctyl]amino]-2-(carbamoylamino)pentanoic acid.
| Compound Name | (2S)-5-[[8-(butylamino)-8-oxooctyl]amino]-2-(carbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 139318625 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (2S)-5-[[8-(butylamino)-8-oxooctyl]amino]-2-(carbamoylamino)pentanoic acid |
| SMILES | CCCCNC(=O)CCCCCCCNCCC[C@H](NC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H36N4O4/c1-2-3-14-21-16(23)11-7-5-4-6-8-12-20-13-9-10-15(17(24)25)22-18(19)26/h15,20H,2-14H2,1H3,(H,21,23)(H,24,25)(H3,19,22,26)/t15-/m0/s1 |
| InChIKey | XWBGTUCSKMKNDW-HNNXBMFYSA-N |
| XLogP | 1.73 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|