C20H21N9S — CID 139321238
3-diazenyl-6-(1-piperidin-4-ylpyrazol-4-yl)-N-(thieno[3,2-c]pyridin-2-ylmethyl)pyrazin-2-amine (PubChem CID 139321238) has the molecular formula C20H21N9S and a molecular weight of 419.52 g/mol. Its IUPAC name is 3-diazenyl-6-(1-piperidin-4-ylpyrazol-4-yl)-N-(thieno[3,2-c]pyridin-2-ylmethyl)pyrazin-2-amine.
| Compound Name | 3-diazenyl-6-(1-piperidin-4-ylpyrazol-4-yl)-N-(thieno[3,2-c]pyridin-2-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 139321238 |
| Molecular Formula | C20H21N9S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-diazenyl-6-(1-piperidin-4-ylpyrazol-4-yl)-N-(thieno[3,2-c]pyridin-2-ylmethyl)pyrazin-2-amine |
| SMILES | [H]/N=N/c1ncc(-c2cnn(C3CCNCC3)c2)nc1NCc1cc2cnccc2s1 |
| InChI | InChI=1S/C20H21N9S/c21-28-20-19(24-10-16-7-13-8-23-6-3-18(13)30-16)27-17(11-25-20)14-9-26-29(12-14)15-1-4-22-5-2-15/h3,6-9,11-12,15,21-22H,1-2,4-5,10H2,(H,24,27)/b28-21+ |
| InChIKey | WLRSDGRMGIYLHE-SGWCAAJKSA-N |
| XLogP | 4.15 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|