C16H14BrN9 — CID 155150047
N-[(3-bromoimidazo[1,2-a]pyridin-6-yl)methyl]-3-diazenyl-6-(1-methylpyrazol-4-yl)pyrazin-2-amine (PubChem CID 155150047) has the molecular formula C16H14BrN9 and a molecular weight of 412.26 g/mol. Its IUPAC name is N-[(3-bromoimidazo[1,2-a]pyridin-6-yl)methyl]-3-diazenyl-6-(1-methylpyrazol-4-yl)pyrazin-2-amine.
| Compound Name | N-[(3-bromoimidazo[1,2-a]pyridin-6-yl)methyl]-3-diazenyl-6-(1-methylpyrazol-4-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 155150047 |
| Molecular Formula | C16H14BrN9 |
| Molecular Weight | 412.26 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[(3-bromoimidazo[1,2-a]pyridin-6-yl)methyl]-3-diazenyl-6-(1-methylpyrazol-4-yl)pyrazin-2-amine |
| SMILES | [H]/N=N/c1ncc(-c2cnn(C)c2)nc1NCc1ccc2ncc(Br)n2c1 |
| InChI | InChI=1S/C16H14BrN9/c1-25-9-11(5-22-25)12-6-21-16(24-18)15(23-12)20-4-10-2-3-14-19-7-13(17)26(14)8-10/h2-3,5-9,18H,4H2,1H3,(H,20,23)/b24-18+ |
| InChIKey | LFVLOOKYPVDYQO-HKOYGPOVSA-N |
| XLogP | 3.56 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|