C18H18N8O — CID 167146802
2-[4-[5-diazenyl-6-(imidazo[1,2-a]pyridin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol (PubChem CID 167146802) has the molecular formula C18H18N8O and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-[4-[5-diazenyl-6-(imidazo[1,2-a]pyridin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[5-diazenyl-6-(imidazo[1,2-a]pyridin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 167146802 |
| Molecular Formula | C18H18N8O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[4-[5-diazenyl-6-(imidazo[1,2-a]pyridin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol |
| SMILES | [H]/N=N/c1ccc(-c2cnn(CCO)c2)nc1NCc1ccc2nccn2c1 |
| InChI | InChI=1S/C18H18N8O/c19-24-16-3-2-15(14-10-22-26(12-14)7-8-27)23-18(16)21-9-13-1-4-17-20-5-6-25(17)11-13/h1-6,10-12,19,27H,7-9H2,(H,21,23)/b24-19+ |
| InChIKey | LWJOSORCLUQISX-LYBHJNIJSA-N |
| XLogP | 2.86 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|