C17H19N9O — CID 167146775
2-[4-[5-hydrazinyl-6-(imidazo[1,2-b]pyridazin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol (PubChem CID 167146775) has the molecular formula C17H19N9O and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-[4-[5-hydrazinyl-6-(imidazo[1,2-b]pyridazin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol.
| Compound Name | 2-[4-[5-hydrazinyl-6-(imidazo[1,2-b]pyridazin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 167146775 |
| Molecular Formula | C17H19N9O |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[4-[5-hydrazinyl-6-(imidazo[1,2-b]pyridazin-6-ylmethylamino)-2-pyridinyl]pyrazol-1-yl]ethanol |
| SMILES | NNc1ccc(-c2cnn(CCO)c2)nc1NCc1ccc2nccn2n1 |
| InChI | InChI=1S/C17H19N9O/c18-23-15-3-2-14(12-9-21-25(11-12)7-8-27)22-17(15)20-10-13-1-4-16-19-5-6-26(16)24-13/h1-6,9,11,23,27H,7-8,10,18H2,(H,20,22) |
| InChIKey | LYKOZBZKKZXQSK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|