C24H25NO3S — CID 139322954
2-(2-phenoxyethoxy)-N-[3-(2-sulfanylpropyl)phenyl]benzamide (PubChem CID 139322954) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)-N-[3-(2-sulfanylpropyl)phenyl]benzamide.
| Compound Name | 2-(2-phenoxyethoxy)-N-[3-(2-sulfanylpropyl)phenyl]benzamide |
|---|---|
| PubChem CID | 139322954 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 2-(2-phenoxyethoxy)-N-[3-(2-sulfanylpropyl)phenyl]benzamide |
| SMILES | CC(S)Cc1cccc(NC(=O)c2ccccc2OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C24H25NO3S/c1-18(29)16-19-8-7-9-20(17-19)25-24(26)22-12-5-6-13-23(22)28-15-14-27-21-10-3-2-4-11-21/h2-13,17-18,29H,14-16H2,1H3,(H,25,26) |
| InChIKey | JGMKJRRDFBSRNK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|