C24H25NO3 — CID 17154818
2-(2-phenylethoxy)-N-(3-propan-2-yloxyphenyl)benzamide (PubChem CID 17154818) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(2-phenylethoxy)-N-(3-propan-2-yloxyphenyl)benzamide.
| Compound Name | 2-(2-phenylethoxy)-N-(3-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 17154818 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-(2-phenylethoxy)-N-(3-propan-2-yloxyphenyl)benzamide |
| SMILES | CC(C)Oc1cccc(NC(=O)c2ccccc2OCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H25NO3/c1-18(2)28-21-12-8-11-20(17-21)25-24(26)22-13-6-7-14-23(22)27-16-15-19-9-4-3-5-10-19/h3-14,17-18H,15-16H2,1-2H3,(H,25,26) |
| InChIKey | FLLPOEFWZUTOJN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |