C37H40N2O4 — CID 139323289
[4-[1-[4-(4-amino-3-methylbenzoyl)oxyphenyl]-3,3,5-trimethylcyclohexyl]phenyl] 3-amino-4-methylbenzoate (PubChem CID 139323289) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is [4-[1-[4-(4-amino-3-methylbenzoyl)oxyphenyl]-3,3,5-trimethylcyclohexyl]phenyl] 3-amino-4-methylbenzoate.
| Compound Name | [4-[1-[4-(4-amino-3-methylbenzoyl)oxyphenyl]-3,3,5-trimethylcyclohexyl]phenyl] 3-amino-4-methylbenzoate |
|---|---|
| PubChem CID | 139323289 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | [4-[1-[4-(4-amino-3-methylbenzoyl)oxyphenyl]-3,3,5-trimethylcyclohexyl]phenyl] 3-amino-4-methylbenzoate |
| SMILES | Cc1cc(C(=O)Oc2ccc(C3(c4ccc(OC(=O)c5ccc(C)c(N)c5)cc4)CC(C)CC(C)(C)C3)cc2)ccc1N |
| InChI | InChI=1S/C37H40N2O4/c1-23-20-36(4,5)22-37(21-23,28-9-13-30(14-10-28)42-34(40)26-8-17-32(38)25(3)18-26)29-11-15-31(16-12-29)43-35(41)27-7-6-24(2)33(39)19-27/h6-19,23H,20-22,38-39H2,1-5H3 |
| InChIKey | OBFSFGAGDXXWLR-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|