C30H42O3 — CID 144930959
[4-[3,3,5-trimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]cyclohexyl]phenyl] 2,2-dimethylpropanoate (PubChem CID 144930959) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is [4-[3,3,5-trimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]cyclohexyl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3,3,5-trimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]cyclohexyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 144930959 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | [4-[3,3,5-trimethyl-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]cyclohexyl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CC1CC(C)(C)CC(c2ccc(OC(=O)C(C)(C)C)cc2)(c2ccc(OC(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C30H42O3/c1-21-18-29(8,9)20-30(19-21,23-12-16-25(17-13-23)33-28(5,6)7)22-10-14-24(15-11-22)32-26(31)27(2,3)4/h10-17,21H,18-20H2,1-9H3 |
| InChIKey | VXDQFRZIPHQWQL-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|